C23H20N6O2 — CID 156597613
1-benzyl-3-[[4-(4-phenyltriazol-1-yl)benzoyl]amino]urea (PubChem CID 156597613) has the molecular formula C23H20N6O2 and a molecular weight of 412.45 g/mol. Its IUPAC name is 1-benzyl-3-[[4-(4-phenyltriazol-1-yl)benzoyl]amino]urea.
| Compound Name | 1-benzyl-3-[[4-(4-phenyltriazol-1-yl)benzoyl]amino]urea |
|---|---|
| PubChem CID | 156597613 |
| Molecular Formula | C23H20N6O2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 1-benzyl-3-[[4-(4-phenyltriazol-1-yl)benzoyl]amino]urea |
| SMILES | O=C(NCc1ccccc1)NNC(=O)c1ccc(-n2cc(-c3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C23H20N6O2/c30-22(26-27-23(31)24-15-17-7-3-1-4-8-17)19-11-13-20(14-12-19)29-16-21(25-28-29)18-9-5-2-6-10-18/h1-14,16H,15H2,(H,26,30)(H2,24,27,31) |
| InChIKey | ZJQMAURJOQTHCL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|