C66H52N12 — CID 44521623
4-phenyl-1-[4-[3,5,7-tris[4-(4-phenyltriazol-1-yl)phenyl]-1-adamantyl]phenyl]triazole (PubChem CID 44521623) has the molecular formula C66H52N12 and a molecular weight of 1013.23 g/mol. Its IUPAC name is 4-phenyl-1-[4-[3,5,7-tris[4-(4-phenyltriazol-1-yl)phenyl]-1-adamantyl]phenyl]triazole.
| Compound Name | 4-phenyl-1-[4-[3,5,7-tris[4-(4-phenyltriazol-1-yl)phenyl]-1-adamantyl]phenyl]triazole |
|---|---|
| PubChem CID | 44521623 |
| Molecular Formula | C66H52N12 |
| Molecular Weight | 1013.23 g/mol |
| Exact Mass | 1012.44 |
| IUPAC Name | 4-phenyl-1-[4-[3,5,7-tris[4-(4-phenyltriazol-1-yl)phenyl]-1-adamantyl]phenyl]triazole |
| SMILES | c1ccc(-c2cn(-c3ccc(C45CC6(c7ccc(-n8cc(-c9ccccc9)nn8)cc7)CC(c7ccc(-n8cc(-c9ccccc9)nn8)cc7)(C4)CC(c4ccc(-n7cc(-c8ccccc8)nn7)cc4)(C5)C6)cc3)nn2)cc1 |
| InChI | InChI=1S/C66H52N12/c1-5-13-47(14-6-1)59-37-75(71-67-59)55-29-21-51(22-30-55)63-41-64(52-23-31-56(32-24-52)76-38-60(68-72-76)48-15-7-2-8-16-48)44-65(42-63,53-25-33-57(34-26-53)77-39-61(69-73-77)49-17-9-3-10-18-49)46-66(43-63,45-64)54-27-35-58(36-28-54)78-40-62(70-74-78)50-19-11-4-12-20-50/h1-40H,41-46H2 |
| InChIKey | UFWKEKJNDGGWJN-UHFFFAOYSA-N |
| XLogP | 13.11 |
| TPSA | 122.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1013.23 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |