C31H38N6O4S — CID 156600881
N-[(1S,2R)-2-[[2-(methylamino)acetyl]amino]cyclohexyl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide (PubChem CID 156600881) has the molecular formula C31H38N6O4S and a molecular weight of 590.75 g/mol. Its IUPAC name is N-[(1S,2R)-2-[[2-(methylamino)acetyl]amino]cyclohexyl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide.
| Compound Name | N-[(1S,2R)-2-[[2-(methylamino)acetyl]amino]cyclohexyl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
|---|---|
| PubChem CID | 156600881 |
| Molecular Formula | C31H38N6O4S |
| Molecular Weight | 590.75 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | N-[(1S,2R)-2-[[2-(methylamino)acetyl]amino]cyclohexyl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
| SMILES | CNCC(=O)N[C@@H]1CCCCC1NC(=O)C1=C2NC(=O)N(c3ccc(Oc4ccccc4)cc3C)C3CCNC(S1)C23 |
| InChI | InChI=1S/C31H38N6O4S/c1-18-16-20(41-19-8-4-3-5-9-19)12-13-23(18)37-24-14-15-33-30-26(24)27(36-31(37)40)28(42-30)29(39)35-22-11-7-6-10-21(22)34-25(38)17-32-2/h3-5,8-9,12-13,16,21-22,24,26,30,32-33H,6-7,10-11,14-15,17H2,1-2H3,(H,34,38)(H,35,39)(H,36,40)/t21-,22?,24?,26?,30?/m1/s1 |
| InChIKey | CPLXFMVJBZYOCA-ASBUCHBPSA-N |
| XLogP | 3.34 |
| TPSA | 123.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.75 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |