C22H21N3O3S — CID 156602199
N-(2-quinolin-8-ylsulfonyl-2-azabicyclo[2.2.1]heptan-5-yl)benzamide (PubChem CID 156602199) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is N-(2-quinolin-8-ylsulfonyl-2-azabicyclo[2.2.1]heptan-5-yl)benzamide.
| Compound Name | N-(2-quinolin-8-ylsulfonyl-2-azabicyclo[2.2.1]heptan-5-yl)benzamide |
|---|---|
| PubChem CID | 156602199 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-(2-quinolin-8-ylsulfonyl-2-azabicyclo[2.2.1]heptan-5-yl)benzamide |
| SMILES | O=C(NC1CC2CC1CN2S(=O)(=O)c1cccc2cccnc12)c1ccccc1 |
| InChI | InChI=1S/C22H21N3O3S/c26-22(16-6-2-1-3-7-16)24-19-13-18-12-17(19)14-25(18)29(27,28)20-10-4-8-15-9-5-11-23-21(15)20/h1-11,17-19H,12-14H2,(H,24,26) |
| InChIKey | GJGWJWJGQINCFZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |