C13H16O5 — CID 156603053
5-(4-methoxy-6-oxopyran-2-yl)-3-methylhex-4-enoic acid (PubChem CID 156603053) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is 5-(4-methoxy-6-oxopyran-2-yl)-3-methylhex-4-enoic acid.
| Compound Name | 5-(4-methoxy-6-oxopyran-2-yl)-3-methylhex-4-enoic acid |
|---|---|
| PubChem CID | 156603053 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 5-(4-methoxy-6-oxopyran-2-yl)-3-methylhex-4-enoic acid |
| SMILES | COc1cc(C(C)=CC(C)CC(=O)O)oc(=O)c1 |
| InChI | InChI=1S/C13H16O5/c1-8(5-12(14)15)4-9(2)11-6-10(17-3)7-13(16)18-11/h4,6-8H,5H2,1-3H3,(H,14,15) |
| InChIKey | KNUGOOSWDXWFQX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |