C17H31NO3 — CID 156603388
cycloheptyl-[4-hydroxy-4-(2-methoxyethyl)-3-methylpiperidin-1-yl]methanone (PubChem CID 156603388) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is cycloheptyl-[4-hydroxy-4-(2-methoxyethyl)-3-methylpiperidin-1-yl]methanone.
| Compound Name | cycloheptyl-[4-hydroxy-4-(2-methoxyethyl)-3-methylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 156603388 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | cycloheptyl-[4-hydroxy-4-(2-methoxyethyl)-3-methylpiperidin-1-yl]methanone |
| SMILES | COCCC1(O)CCN(C(=O)C2CCCCCC2)CC1C |
| InChI | InChI=1S/C17H31NO3/c1-14-13-18(11-9-17(14,20)10-12-21-2)16(19)15-7-5-3-4-6-8-15/h14-15,20H,3-13H2,1-2H3 |
| InChIKey | MPURZGRUOMCPGT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |