C20H29N3O3S — CID 156604820
N-methyl-5-(morpholine-4-carbonyl)-N-(2-phenylsulfanylethyl)piperidine-3-carboxamide (PubChem CID 156604820) has the molecular formula C20H29N3O3S and a molecular weight of 391.54 g/mol. Its IUPAC name is N-methyl-5-(morpholine-4-carbonyl)-N-(2-phenylsulfanylethyl)piperidine-3-carboxamide.
| Compound Name | N-methyl-5-(morpholine-4-carbonyl)-N-(2-phenylsulfanylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 156604820 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-methyl-5-(morpholine-4-carbonyl)-N-(2-phenylsulfanylethyl)piperidine-3-carboxamide |
| SMILES | CN(CCSc1ccccc1)C(=O)C1CNCC(C(=O)N2CCOCC2)C1 |
| InChI | InChI=1S/C20H29N3O3S/c1-22(9-12-27-18-5-3-2-4-6-18)19(24)16-13-17(15-21-14-16)20(25)23-7-10-26-11-8-23/h2-6,16-17,21H,7-15H2,1H3 |
| InChIKey | YCIPCVFXSRBVHH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |