C18H28N4O3 — CID 156605562
2-methyl-N-[1-(oxan-4-yl)-4-propylpyrrolidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 156605562) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-methyl-N-[1-(oxan-4-yl)-4-propylpyrrolidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | 2-methyl-N-[1-(oxan-4-yl)-4-propylpyrrolidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 156605562 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 2-methyl-N-[1-(oxan-4-yl)-4-propylpyrrolidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | CCCC1CN(C2CCOCC2)CC1NC(=O)c1cnc(C)[nH]c1=O |
| InChI | InChI=1S/C18H28N4O3/c1-3-4-13-10-22(14-5-7-25-8-6-14)11-16(13)21-18(24)15-9-19-12(2)20-17(15)23/h9,13-14,16H,3-8,10-11H2,1-2H3,(H,21,24)(H,19,20,23) |
| InChIKey | PSCXWVDETWQBSX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |