C16H26N4O3 — CID 72864856
N-[(3R,4S)-1-(3-methoxypropyl)-4-propylpyrrolidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 72864856) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[(3R,4S)-1-(3-methoxypropyl)-4-propylpyrrolidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-[(3R,4S)-1-(3-methoxypropyl)-4-propylpyrrolidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 72864856 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | N-[(3R,4S)-1-(3-methoxypropyl)-4-propylpyrrolidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | CCC[C@H]1CN(CCCOC)C[C@@H]1NC(=O)c1cnc[nH]c1=O |
| InChI | InChI=1S/C16H26N4O3/c1-3-5-12-9-20(6-4-7-23-2)10-14(12)19-16(22)13-8-17-11-18-15(13)21/h8,11-12,14H,3-7,9-10H2,1-2H3,(H,19,22)(H,17,18,21)/t12-,14-/m0/s1 |
| InChIKey | CPOBIPQRXLTVSM-JSGCOSHPSA-N |
| XLogP | 0.64 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|