C19H30N4O2 — CID 72876645
N-[(3R,4S)-1-[(E)-4-methylhex-3-enyl]-4-propan-2-ylpyrrolidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 72876645) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is N-[(3R,4S)-1-[(E)-4-methylhex-3-enyl]-4-propan-2-ylpyrrolidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-[(3R,4S)-1-[(E)-4-methylhex-3-enyl]-4-propan-2-ylpyrrolidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 72876645 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | N-[(3R,4S)-1-[(E)-4-methylhex-3-enyl]-4-propan-2-ylpyrrolidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | CC/C(C)=C/CCN1C[C@H](NC(=O)c2cnc[nH]c2=O)[C@@H](C(C)C)C1 |
| InChI | InChI=1S/C19H30N4O2/c1-5-14(4)7-6-8-23-10-16(13(2)3)17(11-23)22-19(25)15-9-20-12-21-18(15)24/h7,9,12-13,16-17H,5-6,8,10-11H2,1-4H3,(H,22,25)(H,20,21,24)/b14-7+/t16-,17+/m1/s1 |
| InChIKey | NSPRUZVRHAHMGC-CTLLAADFSA-N |
| XLogP | 2.20 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|