C16H21N5O2 — CID 156608046
1-[2-(4-methoxyphenyl)-5-methylpyrazol-3-yl]-3-pyrrolidin-3-ylurea (PubChem CID 156608046) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)-5-methylpyrazol-3-yl]-3-pyrrolidin-3-ylurea.
| Compound Name | 1-[2-(4-methoxyphenyl)-5-methylpyrazol-3-yl]-3-pyrrolidin-3-ylurea |
|---|---|
| PubChem CID | 156608046 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)-5-methylpyrazol-3-yl]-3-pyrrolidin-3-ylurea |
| SMILES | COc1ccc(-n2nc(C)cc2NC(=O)NC2CCNC2)cc1 |
| InChI | InChI=1S/C16H21N5O2/c1-11-9-15(19-16(22)18-12-7-8-17-10-12)21(20-11)13-3-5-14(23-2)6-4-13/h3-6,9,12,17H,7-8,10H2,1-2H3,(H2,18,19,22) |
| InChIKey | BUVUTDYOMFBWRF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 80.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |