C20H25ClN2O5 — CID 15660944
ethyl 2-[(2S)-1-[4-[(4-chlorophenyl)methyl-methylamino]-4-oxobutanoyl]pyrrolidin-2-yl]-2-oxoacetate (PubChem CID 15660944) has the molecular formula C20H25ClN2O5 and a molecular weight of 408.88 g/mol. Its IUPAC name is ethyl 2-[(2S)-1-[4-[(4-chlorophenyl)methyl-methylamino]-4-oxobutanoyl]pyrrolidin-2-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[(2S)-1-[4-[(4-chlorophenyl)methyl-methylamino]-4-oxobutanoyl]pyrrolidin-2-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 15660944 |
| Molecular Formula | C20H25ClN2O5 |
| Molecular Weight | 408.88 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | ethyl 2-[(2S)-1-[4-[(4-chlorophenyl)methyl-methylamino]-4-oxobutanoyl]pyrrolidin-2-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)[C@@H]1CCCN1C(=O)CCC(=O)N(C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H25ClN2O5/c1-3-28-20(27)19(26)16-5-4-12-23(16)18(25)11-10-17(24)22(2)13-14-6-8-15(21)9-7-14/h6-9,16H,3-5,10-13H2,1-2H3/t16-/m0/s1 |
| InChIKey | NIZYPJVGRZZFIZ-INIZCTEOSA-N |
| XLogP | 2.20 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.88 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|