C20H25NO7 — CID 54160082
ethyl 2-[1-[4-(2,5-dimethoxyphenyl)-4-oxobutanoyl]pyrrolidin-2-yl]-2-oxoacetate (PubChem CID 54160082) has the molecular formula C20H25NO7 and a molecular weight of 391.42 g/mol. Its IUPAC name is ethyl 2-[1-[4-(2,5-dimethoxyphenyl)-4-oxobutanoyl]pyrrolidin-2-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[1-[4-(2,5-dimethoxyphenyl)-4-oxobutanoyl]pyrrolidin-2-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 54160082 |
| Molecular Formula | C20H25NO7 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | ethyl 2-[1-[4-(2,5-dimethoxyphenyl)-4-oxobutanoyl]pyrrolidin-2-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)C1CCCN1C(=O)CCC(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C20H25NO7/c1-4-28-20(25)19(24)15-6-5-11-21(15)18(23)10-8-16(22)14-12-13(26-2)7-9-17(14)27-3/h7,9,12,15H,4-6,8,10-11H2,1-3H3 |
| InChIKey | ONUFDLKSSWFHBW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|