C18H23NO7 — CID 15021098
ethyl 2-oxo-2-[(2S)-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-2-yl]acetate (PubChem CID 15021098) has the molecular formula C18H23NO7 and a molecular weight of 365.38 g/mol. Its IUPAC name is ethyl 2-oxo-2-[(2S)-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-2-yl]acetate.
| Compound Name | ethyl 2-oxo-2-[(2S)-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-2-yl]acetate |
|---|---|
| PubChem CID | 15021098 |
| Molecular Formula | C18H23NO7 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | ethyl 2-oxo-2-[(2S)-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-2-yl]acetate |
| SMILES | CCOC(=O)C(=O)[C@@H]1CCCN1C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C18H23NO7/c1-5-26-18(22)15(20)12-7-6-8-19(12)17(21)11-9-13(23-2)16(25-4)14(10-11)24-3/h9-10,12H,5-8H2,1-4H3/t12-/m0/s1 |
| InChIKey | XIFCWOIXGGZWOM-LBPRGKRZSA-N |
| XLogP | 1.45 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|