C23H35NO4 — CID 143081220
ethyl 1-(3,5-ditert-butyl-4-methoxybenzoyl)pyrrolidine-2-carboxylate (PubChem CID 143081220) has the molecular formula C23H35NO4 and a molecular weight of 389.54 g/mol. Its IUPAC name is ethyl 1-(3,5-ditert-butyl-4-methoxybenzoyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-(3,5-ditert-butyl-4-methoxybenzoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 143081220 |
| Molecular Formula | C23H35NO4 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | ethyl 1-(3,5-ditert-butyl-4-methoxybenzoyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCN1C(=O)c1cc(C(C)(C)C)c(OC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H35NO4/c1-9-28-21(26)18-11-10-12-24(18)20(25)15-13-16(22(2,3)4)19(27-8)17(14-15)23(5,6)7/h13-14,18H,9-12H2,1-8H3 |
| InChIKey | YJSZDXOMTUYFIF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |