C13H10F3N3O2S — CID 156609882
N-(2-methyl-1,3-thiazole-4-carboximidoyl)-4-(trifluoromethoxy)benzamide (PubChem CID 156609882) has the molecular formula C13H10F3N3O2S and a molecular weight of 329.30 g/mol. Its IUPAC name is N-(2-methyl-1,3-thiazole-4-carboximidoyl)-4-(trifluoromethoxy)benzamide.
| Compound Name | N-(2-methyl-1,3-thiazole-4-carboximidoyl)-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 156609882 |
| Molecular Formula | C13H10F3N3O2S |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | N-(2-methyl-1,3-thiazole-4-carboximidoyl)-4-(trifluoromethoxy)benzamide |
| SMILES | [H]/N=C(/NC(=O)c1ccc(OC(F)(F)F)cc1)c1csc(C)n1 |
| InChI | InChI=1S/C13H10F3N3O2S/c1-7-18-10(6-22-7)11(17)19-12(20)8-2-4-9(5-3-8)21-13(14,15)16/h2-6H,1H3,(H2,17,19,20) |
| InChIKey | BZPNKIOZHSQLNC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|