C20H27N5O4S — CID 156612298
4-(1H-indazole-3-carbonyl)-1-methylsulfonyl-3,5,6,7,8a,9,10,11,12,12a-decahydro-2H-benzo[h][1,4,7]triazecin-8-one (PubChem CID 156612298) has the molecular formula C20H27N5O4S and a molecular weight of 433.53 g/mol. Its IUPAC name is 4-(1H-indazole-3-carbonyl)-1-methylsulfonyl-3,5,6,7,8a,9,10,11,12,12a-decahydro-2H-benzo[h][1,4,7]triazecin-8-one.
| Compound Name | 4-(1H-indazole-3-carbonyl)-1-methylsulfonyl-3,5,6,7,8a,9,10,11,12,12a-decahydro-2H-benzo[h][1,4,7]triazecin-8-one |
|---|---|
| PubChem CID | 156612298 |
| Molecular Formula | C20H27N5O4S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 4-(1H-indazole-3-carbonyl)-1-methylsulfonyl-3,5,6,7,8a,9,10,11,12,12a-decahydro-2H-benzo[h][1,4,7]triazecin-8-one |
| SMILES | CS(=O)(=O)N1CCN(C(=O)c2n[nH]c3ccccc23)CCNC(=O)C2CCCCC21 |
| InChI | InChI=1S/C20H27N5O4S/c1-30(28,29)25-13-12-24(11-10-21-19(26)15-7-3-5-9-17(15)25)20(27)18-14-6-2-4-8-16(14)22-23-18/h2,4,6,8,15,17H,3,5,7,9-13H2,1H3,(H,21,26)(H,22,23) |
| InChIKey | RUNIECNEYGYBGO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |