C7H5NO2 — CID 156612494
6aH-cyclopenta[c]pyrrole-1,3-dione (PubChem CID 156612494) has the molecular formula C7H5NO2 and a molecular weight of 135.12 g/mol. Its IUPAC name is 6aH-cyclopenta[c]pyrrole-1,3-dione.
| Compound Name | 6aH-cyclopenta[c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 156612494 |
| Molecular Formula | C7H5NO2 |
| Molecular Weight | 135.12 g/mol |
| Exact Mass | 135.03 |
| IUPAC Name | 6aH-cyclopenta[c]pyrrole-1,3-dione |
| SMILES | O=C1NC(=O)C2C=CC=C12 |
| InChI | InChI=1S/C7H5NO2/c9-6-4-2-1-3-5(4)7(10)8-6/h1-4H,(H,8,9,10) |
| InChIKey | FWSRDPSQCCLZGQ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.12 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|