C7H9NO2 — CID 53439587
3-ethylidene-4-methylpyrrolidine-2,5-dione (PubChem CID 53439587) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is 3-ethylidene-4-methylpyrrolidine-2,5-dione.
| Compound Name | 3-ethylidene-4-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 53439587 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 3-ethylidene-4-methylpyrrolidine-2,5-dione |
| SMILES | CC=C1C(=O)NC(=O)C1C |
| InChI | InChI=1S/C7H9NO2/c1-3-5-4(2)6(9)8-7(5)10/h3-4H,1-2H3,(H,8,9,10) |
| InChIKey | JLAQEZKQOIVCTK-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|