C19H21N3O2S — CID 156612654
4-(4-methoxyphenyl)-3-[4-(2-methylpropoxy)phenyl]-1H-1,2,4-triazole-5-thione (PubChem CID 156612654) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-3-[4-(2-methylpropoxy)phenyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(4-methoxyphenyl)-3-[4-(2-methylpropoxy)phenyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 156612654 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 4-(4-methoxyphenyl)-3-[4-(2-methylpropoxy)phenyl]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc(-n2c(-c3ccc(OCC(C)C)cc3)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C19H21N3O2S/c1-13(2)12-24-17-8-4-14(5-9-17)18-20-21-19(25)22(18)15-6-10-16(23-3)11-7-15/h4-11,13H,12H2,1-3H3,(H,21,25) |
| InChIKey | LBABXQMKMVJLCF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|