C24H22ClN3O4S — CID 132516254
4-(4-chlorophenyl)-3-[4-[(3,4,5-trimethoxyphenyl)methoxy]phenyl]-1H-1,2,4-triazole-5-thione (PubChem CID 132516254) has the molecular formula C24H22ClN3O4S and a molecular weight of 483.98 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-3-[4-[(3,4,5-trimethoxyphenyl)methoxy]phenyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(4-chlorophenyl)-3-[4-[(3,4,5-trimethoxyphenyl)methoxy]phenyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 132516254 |
| Molecular Formula | C24H22ClN3O4S |
| Molecular Weight | 483.98 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 4-(4-chlorophenyl)-3-[4-[(3,4,5-trimethoxyphenyl)methoxy]phenyl]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cc(COc2ccc(-c3n[nH]c(=S)n3-c3ccc(Cl)cc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H22ClN3O4S/c1-29-20-12-15(13-21(30-2)22(20)31-3)14-32-19-10-4-16(5-11-19)23-26-27-24(33)28(23)18-8-6-17(25)7-9-18/h4-13H,14H2,1-3H3,(H,27,33) |
| InChIKey | GENDRNWOVPWGIZ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 70.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.98 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|