C26H26ClN3O5S2 — CID 102496884
3-[4-(4-chlorophenyl)sulfonylphenyl]-4-(3,4,5-triethoxyphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 102496884) has the molecular formula C26H26ClN3O5S2 and a molecular weight of 560.10 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)sulfonylphenyl]-4-(3,4,5-triethoxyphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[4-(4-chlorophenyl)sulfonylphenyl]-4-(3,4,5-triethoxyphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 102496884 |
| Molecular Formula | C26H26ClN3O5S2 |
| Molecular Weight | 560.10 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | 3-[4-(4-chlorophenyl)sulfonylphenyl]-4-(3,4,5-triethoxyphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1cc(-n2c(-c3ccc(S(=O)(=O)c4ccc(Cl)cc4)cc3)n[nH]c2=S)cc(OCC)c1OCC |
| InChI | InChI=1S/C26H26ClN3O5S2/c1-4-33-22-15-19(16-23(34-5-2)24(22)35-6-3)30-25(28-29-26(30)36)17-7-11-20(12-8-17)37(31,32)21-13-9-18(27)10-14-21/h7-16H,4-6H2,1-3H3,(H,29,36) |
| InChIKey | XROXQSLLIDYOLU-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.10 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|