C20H14FN3O2S2 — CID 56961619
3-[4-(benzenesulfonyl)phenyl]-4-(4-fluorophenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 56961619) has the molecular formula C20H14FN3O2S2 and a molecular weight of 411.48 g/mol. Its IUPAC name is 3-[4-(benzenesulfonyl)phenyl]-4-(4-fluorophenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[4-(benzenesulfonyl)phenyl]-4-(4-fluorophenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 56961619 |
| Molecular Formula | C20H14FN3O2S2 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 3-[4-(benzenesulfonyl)phenyl]-4-(4-fluorophenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | O=S(=O)(c1ccccc1)c1ccc(-c2n[nH]c(=S)n2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H14FN3O2S2/c21-15-8-10-16(11-9-15)24-19(22-23-20(24)27)14-6-12-18(13-7-14)28(25,26)17-4-2-1-3-5-17/h1-13H,(H,23,27) |
| InChIKey | KZMQRIYDILPGSJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|