C16H21N3O2S — CID 156613223
3-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2,3-dihydrothiophene-2-carboxamide (PubChem CID 156613223) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 3-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2,3-dihydrothiophene-2-carboxamide.
| Compound Name | 3-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2,3-dihydrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 156613223 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 3-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2,3-dihydrothiophene-2-carboxamide |
| SMILES | CCN(CC)c1ccc(/C=N/C2C=CSC2C(N)=O)c(O)c1 |
| InChI | InChI=1S/C16H21N3O2S/c1-3-19(4-2)12-6-5-11(14(20)9-12)10-18-13-7-8-22-15(13)16(17)21/h5-10,13,15,20H,3-4H2,1-2H3,(H2,17,21)/b18-10+ |
| InChIKey | SQXIOCNQJUKUMF-VCHYOVAHSA-N |
| XLogP | 2.14 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|