C20H17ClN4OS — CID 156613430
2-(2-chlorophenyl)sulfanyl-N-[(4-cyanophenyl)methyl]-N-(1H-imidazol-5-ylmethyl)acetamide (PubChem CID 156613430) has the molecular formula C20H17ClN4OS and a molecular weight of 396.90 g/mol. Its IUPAC name is 2-(2-chlorophenyl)sulfanyl-N-[(4-cyanophenyl)methyl]-N-(1H-imidazol-5-ylmethyl)acetamide.
| Compound Name | 2-(2-chlorophenyl)sulfanyl-N-[(4-cyanophenyl)methyl]-N-(1H-imidazol-5-ylmethyl)acetamide |
|---|---|
| PubChem CID | 156613430 |
| Molecular Formula | C20H17ClN4OS |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 2-(2-chlorophenyl)sulfanyl-N-[(4-cyanophenyl)methyl]-N-(1H-imidazol-5-ylmethyl)acetamide |
| SMILES | N#Cc1ccc(CN(Cc2cnc[nH]2)C(=O)CSc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C20H17ClN4OS/c21-18-3-1-2-4-19(18)27-13-20(26)25(12-17-10-23-14-24-17)11-16-7-5-15(9-22)6-8-16/h1-8,10,14H,11-13H2,(H,23,24) |
| InChIKey | LSTBXSJHAMGXJT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |