C19H19ClN2O2 — CID 156621185
2,6-bis(phenylmethoxy)pyridin-3-amine;hydrochloride (PubChem CID 156621185) has the molecular formula C19H19ClN2O2 and a molecular weight of 342.83 g/mol. Its IUPAC name is 2,6-bis(phenylmethoxy)pyridin-3-amine;hydrochloride.
| Compound Name | 2,6-bis(phenylmethoxy)pyridin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 156621185 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 2,6-bis(phenylmethoxy)pyridin-3-amine;hydrochloride |
| SMILES | Cl.Nc1ccc(OCc2ccccc2)nc1OCc1ccccc1 |
| InChI | InChI=1S/C19H18N2O2.ClH/c20-17-11-12-18(22-13-15-7-3-1-4-8-15)21-19(17)23-14-16-9-5-2-6-10-16;/h1-12H,13-14,20H2;1H |
| InChIKey | BHXWFZWKLXWIHM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |