C41H47F3IrNO2S- — CID 156621933
1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-8-(2-methylpropyl)-[1]benzothiolo[2,3-c]pyridine;(Z)-6-ethyl-1,1,1-trifluoro-5-hydroxy-2,2-dimethyloct-4-en-3-one;iridium (PubChem CID 156621933) has the molecular formula C41H47F3IrNO2S- and a molecular weight of 867.11 g/mol. Its IUPAC name is 1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-8-(2-methylpropyl)-[1]benzothiolo[2,3-c]pyridine;(Z)-6-ethyl-1,1,1-trifluoro-5-hydroxy-2,2-dimethyloct-4-en-3-one;iridium.
| Compound Name | 1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-8-(2-methylpropyl)-[1]benzothiolo[2,3-c]pyridine;(Z)-6-ethyl-1,1,1-trifluoro-5-hydroxy-2,2-dimethyloct-4-en-3-one;iridium |
|---|---|
| PubChem CID | 156621933 |
| Molecular Formula | C41H47F3IrNO2S- |
| Molecular Weight | 867.11 g/mol |
| Exact Mass | 867.29 |
| IUPAC Name | 1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-8-(2-methylpropyl)-[1]benzothiolo[2,3-c]pyridine;(Z)-6-ethyl-1,1,1-trifluoro-5-hydroxy-2,2-dimethyloct-4-en-3-one;iridium |
| SMILES | CC(C)Cc1cccc2c1sc1c(-c3[c-]c4ccccc4c(C(C)(C)C)c3)nccc12.CCC(CC)/C(O)=C/C(=O)C(C)(C)C(F)(F)F.[Ir] |
| InChI | InChI=1S/C29H28NS.C12H19F3O2.Ir/c1-18(2)15-20-10-8-12-23-24-13-14-30-26(28(24)31-27(20)23)21-16-19-9-6-7-11-22(19)25(17-21)29(3,4)5;1-5-8(6-2)9(16)7-10(17)11(3,4)12(13,14)15;/h6-14,17-18H,15H2,1-5H3;7-8,16H,5-6H2,1-4H3;/q-1;;/b;9-7-; |
| InChIKey | JGXZMPOYUPHTKS-ASRJFLFRSA-N |
| XLogP | 12.59 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.11 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|