C42H51F3IrNO2- — CID 154589533
8-(1-cyclopentylethyl)-4-(3,5-dimethylbenzene-6-id-1-yl)-9-(trifluoromethyl)benzo[f]isoquinoline;(Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium (PubChem CID 154589533) has the molecular formula C42H51F3IrNO2- and a molecular weight of 851.09 g/mol. Its IUPAC name is 8-(1-cyclopentylethyl)-4-(3,5-dimethylbenzene-6-id-1-yl)-9-(trifluoromethyl)benzo[f]isoquinoline;(Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium.
| Compound Name | 8-(1-cyclopentylethyl)-4-(3,5-dimethylbenzene-6-id-1-yl)-9-(trifluoromethyl)benzo[f]isoquinoline;(Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 154589533 |
| Molecular Formula | C42H51F3IrNO2- |
| Molecular Weight | 851.09 g/mol |
| Exact Mass | 851.35 |
| IUPAC Name | 8-(1-cyclopentylethyl)-4-(3,5-dimethylbenzene-6-id-1-yl)-9-(trifluoromethyl)benzo[f]isoquinoline;(Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium |
| SMILES | CCC(C)(C)C(=O)/C=C(\O)C(C)(C)CC.Cc1[c-]c(-c2nccc3c2ccc2cc(C(C)C4CCCC4)c(C(F)(F)F)cc23)cc(C)c1.[Ir] |
| InChI | InChI=1S/C29H27F3N.C13H24O2.Ir/c1-17-12-18(2)14-22(13-17)28-24-9-8-21-15-25(19(3)20-6-4-5-7-20)27(29(30,31)32)16-26(21)23(24)10-11-33-28;1-7-12(3,4)10(14)9-11(15)13(5,6)8-2;/h8-13,15-16,19-20H,4-7H2,1-3H3;9,14H,7-8H2,1-6H3;/q-1;;/b;10-9-; |
| InChIKey | UCIQOBMXHMFVHQ-MEILSSRFSA-N |
| XLogP | 12.65 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.09 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|