About CID 58810989
CID 58810989 (PubChem CID 58810989) has the molecular formula C21H10F8NO2Pt-
and a molecular weight of 655.38 g/mol.
Molecular Properties
| Compound Name | CID 58810989 |
| PubChem CID | 58810989 |
| Molecular Formula | C21H10F8NO2Pt- |
| Molecular Weight | 655.38 g/mol |
| Exact Mass | 655.02 |
| IUPAC Name | — |
| SMILES | FC1(F)c2ccc[c-]c2-c2nccc3cccc1c23.O=C(/C=C(\O)C(F)(F)F)C(F)(F)F.[Pt] |
| InChI | InChI=1S/C16H8F2N.C5H2F6O2.Pt/c17-16(18)12-6-2-1-5-11(12)15-14-10(8-9-19-15)4-3-7-13(14)16;6-4(7,8)2(12)1-3(13)5(9,10)11;/h1-4,6-9H;1,12H;/q-1;;/b;2-1-; |
| InChIKey | CSMQWDYNJRYKDV-FJOGWHKWSA-N |
| XLogP | 6.27 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 655.38 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 58810989 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58810989?
The IUPAC name of CID 58810989 (CID 58810989) is not available.
What is the SMILES notation for CID 58810989?
The canonical SMILES for CID 58810989 is FC1(F)c2ccc[c-]c2-c2nccc3cccc1c23.O=C(/C=C(\O)C(F)(F)F)C(F)(F)F.[Pt].
What is the InChIKey of CID 58810989?
The InChIKey is CSMQWDYNJRYKDV-FJOGWHKWSA-N. The full InChI is InChI=1S/C16H8F2N.C5H2F6O2.Pt/c17-16(18)12-6-2-1-5-11(12)15-14-10(8-9-19-15)4-3-7-13(14)16;6-4(7,8)2(12)1-3(13)5(9,10)11;/h1-4,6-9H;1,12H;/q-1;;/b;2-1-;.
What are the key properties of CID 58810989?
CID 58810989 has a molecular weight of 655.38 g/mol, XLogP of 6.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58810989 is sourced from PubChem (CID 58810989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).