C21H10F8NO2Pt- — CID 58810989
CID 58810989 (PubChem CID 58810989) has the molecular formula C21H10F8NO2Pt- and a molecular weight of 655.38 g/mol.
| Compound Name | CID 58810989 |
|---|---|
| PubChem CID | 58810989 |
| Molecular Formula | C21H10F8NO2Pt- |
| Molecular Weight | 655.38 g/mol |
| Exact Mass | 655.02 |
| IUPAC Name | — |
| SMILES | FC1(F)c2ccc[c-]c2-c2nccc3cccc1c23.O=C(/C=C(\O)C(F)(F)F)C(F)(F)F.[Pt] |
| InChI | InChI=1S/C16H8F2N.C5H2F6O2.Pt/c17-16(18)12-6-2-1-5-11(12)15-14-10(8-9-19-15)4-3-7-13(14)16;6-4(7,8)2(12)1-3(13)5(9,10)11;/h1-4,6-9H;1,12H;/q-1;;/b;2-1-; |
| InChIKey | CSMQWDYNJRYKDV-FJOGWHKWSA-N |
| XLogP | 6.27 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.38 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|