C13H16N4O4 — CID 156622018
4-[(2R)-3-(5-ethyltetrazol-2-yl)-2-hydroxypropoxy]benzoic acid (PubChem CID 156622018) has the molecular formula C13H16N4O4 and a molecular weight of 292.30 g/mol. Its IUPAC name is 4-[(2R)-3-(5-ethyltetrazol-2-yl)-2-hydroxypropoxy]benzoic acid.
| Compound Name | 4-[(2R)-3-(5-ethyltetrazol-2-yl)-2-hydroxypropoxy]benzoic acid |
|---|---|
| PubChem CID | 156622018 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 4-[(2R)-3-(5-ethyltetrazol-2-yl)-2-hydroxypropoxy]benzoic acid |
| SMILES | CCc1nnn(C[C@@H](O)COc2ccc(C(=O)O)cc2)n1 |
| InChI | InChI=1S/C13H16N4O4/c1-2-12-14-16-17(15-12)7-10(18)8-21-11-5-3-9(4-6-11)13(19)20/h3-6,10,18H,2,7-8H2,1H3,(H,19,20)/t10-/m1/s1 |
| InChIKey | PXSLZEFRZIDYAS-SNVBAGLBSA-N |
| XLogP | 0.37 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |