C16H15N3O4 — CID 40563095
4-[(2R)-3-(benzotriazol-1-yl)-2-hydroxypropoxy]benzoic acid (PubChem CID 40563095) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is 4-[(2R)-3-(benzotriazol-1-yl)-2-hydroxypropoxy]benzoic acid.
| Compound Name | 4-[(2R)-3-(benzotriazol-1-yl)-2-hydroxypropoxy]benzoic acid |
|---|---|
| PubChem CID | 40563095 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 4-[(2R)-3-(benzotriazol-1-yl)-2-hydroxypropoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OC[C@H](O)Cn2nnc3ccccc32)cc1 |
| InChI | InChI=1S/C16H15N3O4/c20-12(9-19-15-4-2-1-3-14(15)17-18-19)10-23-13-7-5-11(6-8-13)16(21)22/h1-8,12,20H,9-10H2,(H,21,22)/t12-/m1/s1 |
| InChIKey | BXJWQRFCIGSXNO-GFCCVEGCSA-N |
| XLogP | 1.57 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |