C27H31N — CID 156627665
N-tert-butyl-4-ethyl-9,9-dimethyl-N-phenylfluoren-3-amine (PubChem CID 156627665) has the molecular formula C27H31N and a molecular weight of 369.55 g/mol. Its IUPAC name is N-tert-butyl-4-ethyl-9,9-dimethyl-N-phenylfluoren-3-amine.
| Compound Name | N-tert-butyl-4-ethyl-9,9-dimethyl-N-phenylfluoren-3-amine |
|---|---|
| PubChem CID | 156627665 |
| Molecular Formula | C27H31N |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | N-tert-butyl-4-ethyl-9,9-dimethyl-N-phenylfluoren-3-amine |
| SMILES | CCc1c(N(c2ccccc2)C(C)(C)C)ccc2c1-c1ccccc1C2(C)C |
| InChI | InChI=1S/C27H31N/c1-7-20-24(28(26(2,3)4)19-13-9-8-10-14-19)18-17-23-25(20)21-15-11-12-16-22(21)27(23,5)6/h8-18H,7H2,1-6H3 |
| InChIKey | GNILMHQEYYHYEZ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |