C24H27BrN6O — CID 156628033
4-[(2S,5R)-4-[1-[4-(bromomethyl)phenyl]ethyl]-2,5-dimethylpiperazin-1-yl]-6-isocyano-1-methylpyrido[3,2-d]pyrimidin-2-one (PubChem CID 156628033) has the molecular formula C24H27BrN6O and a molecular weight of 495.43 g/mol. Its IUPAC name is 4-[(2S,5R)-4-[1-[4-(bromomethyl)phenyl]ethyl]-2,5-dimethylpiperazin-1-yl]-6-isocyano-1-methylpyrido[3,2-d]pyrimidin-2-one.
| Compound Name | 4-[(2S,5R)-4-[1-[4-(bromomethyl)phenyl]ethyl]-2,5-dimethylpiperazin-1-yl]-6-isocyano-1-methylpyrido[3,2-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 156628033 |
| Molecular Formula | C24H27BrN6O |
| Molecular Weight | 495.43 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 4-[(2S,5R)-4-[1-[4-(bromomethyl)phenyl]ethyl]-2,5-dimethylpiperazin-1-yl]-6-isocyano-1-methylpyrido[3,2-d]pyrimidin-2-one |
| SMILES | [C-]#[N+]c1ccc2c(n1)c(N1C[C@@H](C)N(C(C)c3ccc(CBr)cc3)C[C@@H]1C)nc(=O)n2C |
| InChI | InChI=1S/C24H27BrN6O/c1-15-14-31(16(2)13-30(15)17(3)19-8-6-18(12-25)7-9-19)23-22-20(29(5)24(32)28-23)10-11-21(26-4)27-22/h6-11,15-17H,12-14H2,1-3,5H3/t15-,16+,17?/m1/s1 |
| InChIKey | BMLMDVRVNNHPJD-GARXDOFDSA-N |
| XLogP | 4.43 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|