C23H23F3N6O — CID 156628105
4-[(2S,5R)-2,5-dimethyl-4-[1-(3,4,5-trifluorophenyl)ethyl]piperazin-1-yl]-6-isocyano-1-methylpyrido[3,2-d]pyrimidin-2-one (PubChem CID 156628105) has the molecular formula C23H23F3N6O and a molecular weight of 456.47 g/mol. Its IUPAC name is 4-[(2S,5R)-2,5-dimethyl-4-[1-(3,4,5-trifluorophenyl)ethyl]piperazin-1-yl]-6-isocyano-1-methylpyrido[3,2-d]pyrimidin-2-one.
| Compound Name | 4-[(2S,5R)-2,5-dimethyl-4-[1-(3,4,5-trifluorophenyl)ethyl]piperazin-1-yl]-6-isocyano-1-methylpyrido[3,2-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 156628105 |
| Molecular Formula | C23H23F3N6O |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 4-[(2S,5R)-2,5-dimethyl-4-[1-(3,4,5-trifluorophenyl)ethyl]piperazin-1-yl]-6-isocyano-1-methylpyrido[3,2-d]pyrimidin-2-one |
| SMILES | [C-]#[N+]c1ccc2c(n1)c(N1C[C@@H](C)N(C(C)c3cc(F)c(F)c(F)c3)C[C@@H]1C)nc(=O)n2C |
| InChI | InChI=1S/C23H23F3N6O/c1-12-11-32(22-21-18(30(5)23(33)29-22)6-7-19(27-4)28-21)13(2)10-31(12)14(3)15-8-16(24)20(26)17(25)9-15/h6-9,12-14H,10-11H2,1-3,5H3/t12-,13+,14?/m1/s1 |
| InChIKey | BYMTWLLODKDVRM-AMIUJLCOSA-N |
| XLogP | 3.96 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|