C34H28BN3O2S — CID 156628608
4-carbazol-9-yl-2-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzothiolo[3,2-d]pyrimidine (PubChem CID 156628608) has the molecular formula C34H28BN3O2S and a molecular weight of 553.50 g/mol. Its IUPAC name is 4-carbazol-9-yl-2-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzothiolo[3,2-d]pyrimidine.
| Compound Name | 4-carbazol-9-yl-2-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzothiolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 156628608 |
| Molecular Formula | C34H28BN3O2S |
| Molecular Weight | 553.50 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | 4-carbazol-9-yl-2-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzothiolo[3,2-d]pyrimidine |
| SMILES | CC1(C)OB(c2ccc3sc4c(-n5c6ccccc6c6ccccc65)nc(-c5ccccc5)nc4c3c2)OC1(C)C |
| InChI | InChI=1S/C34H28BN3O2S/c1-33(2)34(3,4)40-35(39-33)22-18-19-28-25(20-22)29-30(41-28)32(37-31(36-29)21-12-6-5-7-13-21)38-26-16-10-8-14-23(26)24-15-9-11-17-27(24)38/h5-20H,1-4H3 |
| InChIKey | FPQNANZPEHMDEU-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.50 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|