C10H15ClF2O2 — CID 156629085
ethyl 2-(4-chloro-3-deuteriocyclohexyl)-2,2-difluoroacetate (PubChem CID 156629085) has the molecular formula C10H15ClF2O2 and a molecular weight of 241.68 g/mol. Its IUPAC name is ethyl 2-(4-chloro-3-deuteriocyclohexyl)-2,2-difluoroacetate.
| Compound Name | ethyl 2-(4-chloro-3-deuteriocyclohexyl)-2,2-difluoroacetate |
|---|---|
| PubChem CID | 156629085 |
| Molecular Formula | C10H15ClF2O2 |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | ethyl 2-(4-chloro-3-deuteriocyclohexyl)-2,2-difluoroacetate |
| SMILES | [2H]C1CC(C(F)(F)C(=O)OCC)CCC1Cl |
| InChI | InChI=1S/C10H15ClF2O2/c1-2-15-9(14)10(12,13)7-3-5-8(11)6-4-7/h7-8H,2-6H2,1H3/i5D |
| InChIKey | YXQMIISYUMSLTR-UICOGKGYSA-N |
| XLogP | 2.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|