C52H51BN4 — CID 156629891
11-ethyl-8,14-bis(4-ethylphenyl)-4,18-bis(4-propan-2-yl-2-pyridinyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 156629891) has the molecular formula C52H51BN4 and a molecular weight of 742.82 g/mol. Its IUPAC name is 11-ethyl-8,14-bis(4-ethylphenyl)-4,18-bis(4-propan-2-yl-2-pyridinyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 11-ethyl-8,14-bis(4-ethylphenyl)-4,18-bis(4-propan-2-yl-2-pyridinyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 156629891 |
| Molecular Formula | C52H51BN4 |
| Molecular Weight | 742.82 g/mol |
| Exact Mass | 742.42 |
| IUPAC Name | 11-ethyl-8,14-bis(4-ethylphenyl)-4,18-bis(4-propan-2-yl-2-pyridinyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | CCc1ccc(N2c3ccc(-c4cc(C(C)C)ccn4)cc3B3c4cc(-c5cc(C(C)C)ccn5)ccc4N(c4ccc(CC)cc4)c4cc(CC)cc2c43)cc1 |
| InChI | InChI=1S/C52H51BN4/c1-8-35-11-17-42(18-12-35)56-48-21-15-40(46-31-38(33(4)5)23-25-54-46)29-44(48)53-45-30-41(47-32-39(34(6)7)24-26-55-47)16-22-49(45)57(43-19-13-36(9-2)14-20-43)51-28-37(10-3)27-50(56)52(51)53/h11-34H,8-10H2,1-7H3 |
| InChIKey | AUTWMNTVKHNOTG-UHFFFAOYSA-N |
| XLogP | 11.83 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.82 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|