C57H60BN3 — CID 177263931
4,18-ditert-butyl-8,14-bis(4-tert-butylphenyl)-11-(6-phenyl-3-pyridinyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 177263931) has the molecular formula C57H60BN3 and a molecular weight of 797.94 g/mol. Its IUPAC name is 4,18-ditert-butyl-8,14-bis(4-tert-butylphenyl)-11-(6-phenyl-3-pyridinyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 4,18-ditert-butyl-8,14-bis(4-tert-butylphenyl)-11-(6-phenyl-3-pyridinyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 177263931 |
| Molecular Formula | C57H60BN3 |
| Molecular Weight | 797.94 g/mol |
| Exact Mass | 797.49 |
| IUPAC Name | 4,18-ditert-butyl-8,14-bis(4-tert-butylphenyl)-11-(6-phenyl-3-pyridinyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | CC(C)(C)c1ccc(N2c3ccc(C(C)(C)C)cc3B3c4cc(C(C)(C)C)ccc4N(c4ccc(C(C)(C)C)cc4)c4cc(-c5ccc(-c6ccccc6)nc5)cc2c43)cc1 |
| InChI | InChI=1S/C57H60BN3/c1-54(2,3)40-19-25-44(26-20-40)60-49-30-23-42(56(7,8)9)34-46(49)58-47-35-43(57(10,11)12)24-31-50(47)61(45-27-21-41(22-28-45)55(4,5)6)52-33-39(32-51(60)53(52)58)38-18-29-48(59-36-38)37-16-14-13-15-17-37/h13-36H,1-12H3 |
| InChIKey | KABOCUXHMSPHSA-UHFFFAOYSA-N |
| XLogP | 13.69 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.94 |
| LogP ≤ 5 | 13.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|