C13H21NO2 — CID 156630164
1-[4-(3,3-dimethylbut-1-ynyl)-4-hydroxypiperidin-1-yl]ethanone (PubChem CID 156630164) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-[4-(3,3-dimethylbut-1-ynyl)-4-hydroxypiperidin-1-yl]ethanone.
| Compound Name | 1-[4-(3,3-dimethylbut-1-ynyl)-4-hydroxypiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 156630164 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 1-[4-(3,3-dimethylbut-1-ynyl)-4-hydroxypiperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(O)(C#CC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H21NO2/c1-11(15)14-9-7-13(16,8-10-14)6-5-12(2,3)4/h16H,7-10H2,1-4H3 |
| InChIKey | UENZWAGLBQNFJQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|