C23H36O2 — CID 158679716
1-(3,3-dimethylbut-1-ynyl)cyclobutan-1-ol;2-(3,3-dimethylbut-1-ynyl)spiro[3.3]heptan-2-ol (PubChem CID 158679716) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is 1-(3,3-dimethylbut-1-ynyl)cyclobutan-1-ol;2-(3,3-dimethylbut-1-ynyl)spiro[3.3]heptan-2-ol.
| Compound Name | 1-(3,3-dimethylbut-1-ynyl)cyclobutan-1-ol;2-(3,3-dimethylbut-1-ynyl)spiro[3.3]heptan-2-ol |
|---|---|
| PubChem CID | 158679716 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | 1-(3,3-dimethylbut-1-ynyl)cyclobutan-1-ol;2-(3,3-dimethylbut-1-ynyl)spiro[3.3]heptan-2-ol |
| SMILES | CC(C)(C)C#CC1(O)CC2(CCC2)C1.CC(C)(C)C#CC1(O)CCC1 |
| InChI | InChI=1S/C13H20O.C10H16O/c1-11(2,3)7-8-13(14)9-12(10-13)5-4-6-12;1-9(2,3)7-8-10(11)5-4-6-10/h14H,4-6,9-10H2,1-3H3;11H,4-6H2,1-3H3 |
| InChIKey | IEYROHQKNYRNIT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|