C10H18N4 — CID 156630757
6-methyl-6-(6-methyl-1,5-diazabicyclo[3.1.0]hexan-6-yl)-1,5-diazabicyclo[3.1.0]hexane (PubChem CID 156630757) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 6-methyl-6-(6-methyl-1,5-diazabicyclo[3.1.0]hexan-6-yl)-1,5-diazabicyclo[3.1.0]hexane.
| Compound Name | 6-methyl-6-(6-methyl-1,5-diazabicyclo[3.1.0]hexan-6-yl)-1,5-diazabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 156630757 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 6-methyl-6-(6-methyl-1,5-diazabicyclo[3.1.0]hexan-6-yl)-1,5-diazabicyclo[3.1.0]hexane |
| SMILES | CC1(C2(C)N3CCCN32)N2CCCN21 |
| InChI | InChI=1S/C10H18N4/c1-9(11-5-3-6-12(9)11)10(2)13-7-4-8-14(10)13/h3-8H2,1-2H3 |
| InChIKey | WDJVUWQOBJHYCK-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 12.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|