C36H42N12O12 — CID 156632553
1,3,5-tris[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]ethyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 156632553) has the molecular formula C36H42N12O12 and a molecular weight of 834.80 g/mol. Its IUPAC name is 1,3,5-tris[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]ethyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]ethyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 156632553 |
| Molecular Formula | C36H42N12O12 |
| Molecular Weight | 834.80 g/mol |
| Exact Mass | 834.30 |
| IUPAC Name | 1,3,5-tris[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]ethyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CCn2c(=O)n(CCn3c(=O)n(CC=C)c(=O)n(CC=C)c3=O)c(=O)n(CCn3c(=O)n(CC=C)c(=O)n(CC=C)c3=O)c2=O)c1=O |
| InChI | InChI=1S/C36H42N12O12/c1-7-13-37-25(49)38(14-8-2)29(53)43(28(37)52)19-22-46-34(58)47(23-20-44-30(54)39(15-9-3)26(50)40(16-10-4)31(44)55)36(60)48(35(46)59)24-21-45-32(56)41(17-11-5)27(51)42(18-12-6)33(45)57/h7-12H,1-6,13-24H2 |
| InChIKey | FQGKKYDQFZKBGM-UHFFFAOYSA-N |
| XLogP | -5.16 |
| TPSA | 264.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.80 |
| LogP ≤ 5 | -5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|