C33H42N10O9 — CID 15836290
1-[2-[bis[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]ethyl]amino]ethyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 15836290) has the molecular formula C33H42N10O9 and a molecular weight of 722.76 g/mol. Its IUPAC name is 1-[2-[bis[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]ethyl]amino]ethyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[2-[bis[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]ethyl]amino]ethyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 15836290 |
| Molecular Formula | C33H42N10O9 |
| Molecular Weight | 722.76 g/mol |
| Exact Mass | 722.31 |
| IUPAC Name | 1-[2-[bis[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]ethyl]amino]ethyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CCN(CCn2c(=O)n(CC=C)c(=O)n(CC=C)c2=O)CCn2c(=O)n(CC=C)c(=O)n(CC=C)c2=O)c1=O |
| InChI | InChI=1S/C33H42N10O9/c1-7-13-35-25(44)36(14-8-2)29(48)41(28(35)47)22-19-34(20-23-42-30(49)37(15-9-3)26(45)38(16-10-4)31(42)50)21-24-43-32(51)39(17-11-5)27(46)40(18-12-6)33(43)52/h7-12H,1-6,13-24H2 |
| InChIKey | VVZXGWNKDMEWJR-UHFFFAOYSA-N |
| XLogP | -3.04 |
| TPSA | 201.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.76 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|