C30H36N9O9PS — CID 2783950
1-[bis[[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]methyl]phosphinothioylmethyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 2783950) has the molecular formula C30H36N9O9PS and a molecular weight of 729.71 g/mol. Its IUPAC name is 1-[bis[[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]methyl]phosphinothioylmethyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[bis[[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]methyl]phosphinothioylmethyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2783950 |
| Molecular Formula | C30H36N9O9PS |
| Molecular Weight | 729.71 g/mol |
| Exact Mass | 729.21 |
| IUPAC Name | 1-[bis[[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]methyl]phosphinothioylmethyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CP(=S)(Cn2c(=O)n(CC=C)c(=O)n(CC=C)c2=O)Cn2c(=O)n(CC=C)c(=O)n(CC=C)c2=O)c1=O |
| InChI | InChI=1S/C30H36N9O9PS/c1-7-13-31-22(40)32(14-8-2)26(44)37(25(31)43)19-49(50,20-38-27(45)33(15-9-3)23(41)34(16-10-4)28(38)46)21-39-29(47)35(17-11-5)24(42)36(18-12-6)30(39)48/h7-12H,1-6,13-21H2 |
| InChIKey | VIJOIIFJCWWGAZ-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 198.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.71 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|