C17H17F5Si — CID 156634604
benzyl-dimethyl-[2-(2,3,4,5,6-pentafluorophenyl)ethyl]silane (PubChem CID 156634604) has the molecular formula C17H17F5Si and a molecular weight of 344.40 g/mol. Its IUPAC name is benzyl-dimethyl-[2-(2,3,4,5,6-pentafluorophenyl)ethyl]silane.
| Compound Name | benzyl-dimethyl-[2-(2,3,4,5,6-pentafluorophenyl)ethyl]silane |
|---|---|
| PubChem CID | 156634604 |
| Molecular Formula | C17H17F5Si |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | benzyl-dimethyl-[2-(2,3,4,5,6-pentafluorophenyl)ethyl]silane |
| SMILES | C[Si](C)(CCc1c(F)c(F)c(F)c(F)c1F)Cc1ccccc1 |
| InChI | InChI=1S/C17H17F5Si/c1-23(2,10-11-6-4-3-5-7-11)9-8-12-13(18)15(20)17(22)16(21)14(12)19/h3-7H,8-10H2,1-2H3 |
| InChIKey | VTNQVPJEACBUCP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|