C29H25F5Sn — CID 177398927
tribenzyl-[2-(2,3,4,5,6-pentafluorophenyl)ethyl]stannane (PubChem CID 177398927) has the molecular formula C29H25F5Sn and a molecular weight of 587.22 g/mol. Its IUPAC name is tribenzyl-[2-(2,3,4,5,6-pentafluorophenyl)ethyl]stannane.
| Compound Name | tribenzyl-[2-(2,3,4,5,6-pentafluorophenyl)ethyl]stannane |
|---|---|
| PubChem CID | 177398927 |
| Molecular Formula | C29H25F5Sn |
| Molecular Weight | 587.22 g/mol |
| Exact Mass | 588.09 |
| IUPAC Name | tribenzyl-[2-(2,3,4,5,6-pentafluorophenyl)ethyl]stannane |
| SMILES | Fc1c(F)c(F)c(CC[Sn](Cc2ccccc2)(Cc2ccccc2)Cc2ccccc2)c(F)c1F |
| InChI | InChI=1S/C8H4F5.3C7H7.Sn/c1-2-3-4(9)6(11)8(13)7(12)5(3)10;3*1-7-5-3-2-4-6-7;/h1-2H2;3*2-6H,1H2; |
| InChIKey | XAWOSSSODZAXDX-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.22 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|