C14H13N5O2 — CID 156635565
6-(5-amino-3-oxo-1H-isoindol-2-yl)pyridine-2-carbohydrazide (PubChem CID 156635565) has the molecular formula C14H13N5O2 and a molecular weight of 283.29 g/mol. Its IUPAC name is 6-(5-amino-3-oxo-1H-isoindol-2-yl)pyridine-2-carbohydrazide.
| Compound Name | 6-(5-amino-3-oxo-1H-isoindol-2-yl)pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 156635565 |
| Molecular Formula | C14H13N5O2 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 6-(5-amino-3-oxo-1H-isoindol-2-yl)pyridine-2-carbohydrazide |
| SMILES | NNC(=O)c1cccc(N2Cc3ccc(N)cc3C2=O)n1 |
| InChI | InChI=1S/C14H13N5O2/c15-9-5-4-8-7-19(14(21)10(8)6-9)12-3-1-2-11(17-12)13(20)18-16/h1-6H,7,15-16H2,(H,18,20) |
| InChIKey | DUIBLMAJRKXKJY-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|