About 2-[2,5-dideuterio-3,4-bis(phenylmethoxy)phenyl]acetonitrile
2-[2,5-dideuterio-3,4-bis(phenylmethoxy)phenyl]acetonitrile (PubChem CID 156636132) has the molecular formula C22H19NO2
and a molecular weight of 331.41 g/mol. Its IUPAC name is 2-[2,5-dideuterio-3,4-bis(phenylmethoxy)phenyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[2,5-dideuterio-3,4-bis(phenylmethoxy)phenyl]acetonitrile |
| PubChem CID | 156636132 |
| Molecular Formula | C22H19NO2 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-[2,5-dideuterio-3,4-bis(phenylmethoxy)phenyl]acetonitrile |
| SMILES | [2H]c1cc(CC#N)c([2H])c(OCc2ccccc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C22H19NO2/c23-14-13-18-11-12-21(24-16-19-7-3-1-4-8-19)22(15-18)25-17-20-9-5-2-6-10-20/h1-12,15H,13,16-17H2/i12D,15D |
| InChIKey | JVNGVPICFBYTGS-HBQVVMJPSA-N |
| XLogP | 4.91 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2,5-dideuterio-3,4-bis(phenylmethoxy)phenyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,5-dideuterio-3,4-bis(phenylmethoxy)phenyl]acetonitrile?
The IUPAC name of 2-[2,5-dideuterio-3,4-bis(phenylmethoxy)phenyl]acetonitrile (CID 156636132) is 2-[2,5-dideuterio-3,4-bis(phenylmethoxy)phenyl]acetonitrile.
What is the SMILES notation for 2-[2,5-dideuterio-3,4-bis(phenylmethoxy)phenyl]acetonitrile?
The canonical SMILES for 2-[2,5-dideuterio-3,4-bis(phenylmethoxy)phenyl]acetonitrile is [2H]c1cc(CC#N)c([2H])c(OCc2ccccc2)c1OCc1ccccc1.
What is the InChIKey of 2-[2,5-dideuterio-3,4-bis(phenylmethoxy)phenyl]acetonitrile?
The InChIKey is JVNGVPICFBYTGS-HBQVVMJPSA-N. The full InChI is InChI=1S/C22H19NO2/c23-14-13-18-11-12-21(24-16-19-7-3-1-4-8-19)22(15-18)25-17-20-9-5-2-6-10-20/h1-12,15H,13,16-17H2/i12D,15D.
What are the key properties of 2-[2,5-dideuterio-3,4-bis(phenylmethoxy)phenyl]acetonitrile?
2-[2,5-dideuterio-3,4-bis(phenylmethoxy)phenyl]acetonitrile has a molecular weight of 331.41 g/mol, XLogP of 4.91, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,5-dideuterio-3,4-bis(phenylmethoxy)phenyl]acetonitrile is sourced from PubChem (CID 156636132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).