C18H18IN3O — CID 18945028
2-(1,2-dimethyl-8-phenylmethoxyimidazo[1,2-a]pyridin-4-ium-3-yl)acetonitrile iodide (PubChem CID 18945028) has the molecular formula C18H18IN3O and a molecular weight of 419.27 g/mol. Its IUPAC name is 2-(1,2-dimethyl-8-phenylmethoxyimidazo[1,2-a]pyridin-4-ium-3-yl)acetonitrile iodide.
| Compound Name | 2-(1,2-dimethyl-8-phenylmethoxyimidazo[1,2-a]pyridin-4-ium-3-yl)acetonitrile iodide |
|---|---|
| PubChem CID | 18945028 |
| Molecular Formula | C18H18IN3O |
| Molecular Weight | 419.27 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 2-(1,2-dimethyl-8-phenylmethoxyimidazo[1,2-a]pyridin-4-ium-3-yl)acetonitrile iodide |
| SMILES | Cc1c(CC#N)[n+]2cccc(OCc3ccccc3)c2n1C.[I-] |
| InChI | InChI=1S/C18H18N3O.HI/c1-14-16(10-11-19)21-12-6-9-17(18(21)20(14)2)22-13-15-7-4-3-5-8-15;/h3-9,12H,10,13H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | JGDOTALYCVDOJO-UHFFFAOYSA-M |
| XLogP | -0.28 |
| TPSA | 42.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.27 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|