C25H27ClN2O — CID 18945060
1-[(3,5-dimethylphenyl)methyl]-2,3-dimethyl-8-phenylmethoxyimidazo[1,2-a]pyridin-1-ium chloride (PubChem CID 18945060) has the molecular formula C25H27ClN2O and a molecular weight of 406.96 g/mol. Its IUPAC name is 1-[(3,5-dimethylphenyl)methyl]-2,3-dimethyl-8-phenylmethoxyimidazo[1,2-a]pyridin-1-ium chloride.
| Compound Name | 1-[(3,5-dimethylphenyl)methyl]-2,3-dimethyl-8-phenylmethoxyimidazo[1,2-a]pyridin-1-ium chloride |
|---|---|
| PubChem CID | 18945060 |
| Molecular Formula | C25H27ClN2O |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 1-[(3,5-dimethylphenyl)methyl]-2,3-dimethyl-8-phenylmethoxyimidazo[1,2-a]pyridin-1-ium chloride |
| SMILES | Cc1cc(C)cc(C[n+]2c(C)c(C)n3cccc(OCc4ccccc4)c32)c1.[Cl-] |
| InChI | InChI=1S/C25H27N2O.ClH/c1-18-13-19(2)15-23(14-18)16-27-21(4)20(3)26-12-8-11-24(25(26)27)28-17-22-9-6-5-7-10-22;/h5-15H,16-17H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | QRMFGONJLYSJRN-UHFFFAOYSA-M |
| XLogP | 2.09 |
| TPSA | 17.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|